9H-Purine, 2-chloro-
1H-Purine, 2-chloro-
CAS: 1681-15-8
Molecular Formula: C5H3ClN4
9H-Purine, 2-chloro- - Names and Identifiers
| Name | 1H-Purine, 2-chloro- |
| Synonyms | 2-Chloropurine 2-CHLOROPURINE 2-chloro-7H-purine 2-chloro-5H-purine 2-Chloro-7H-purine 9H-Purine, 2-chloro- 1H-Purine, 2-chloro- Tenofovir Impurity 88 |
| CAS | 1681-15-8 |
| InChI | InChI=1/C5H3ClN4/c6-5-7-1-3-4(10-5)9-2-8-3/h1-2H,(H,7,8,9,10) |
9H-Purine, 2-chloro- - Physico-chemical Properties
| Molecular Formula | C5H3ClN4 |
| Molar Mass | 154.56 |
| Density | 1.84±0.1 g/cm3(Predicted) |
| Melting Point | 231-234 °C |
| Boling Point | 287.9±23.0 °C(Predicted) |
| Flash Point | 226.5°C |
| Vapor Presure | 3.58E-06mmHg at 25°C |
| pKa | 6.58±0.20(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| Refractive Index | 1.739 |
9H-Purine, 2-chloro- - Introduction
1H-Purine, 2-chloro-is an organic compound with the chemical formula C5H3ClN4. The following is a description of the nature, use, preparation and safety information of 1H-Purine, 2-chlorine:
Nature:
1. Appearance: 1H-Purine, 2-chlorine-is a colorless crystalline solid.
2. Melting Point: about 287-290 degrees Celsius.
3. Solubility: 1H-Purine, 2-chloro-insoluble in water, but soluble in organic solvents such as methanol, ethanol and dimethyl sulfoxide.
4. Stability: relatively stable at room temperature, but easy to decompose under higher temperature and light conditions.
Use:
1. Drug: 1H-Purine, 2-chlorine-is an important drug intermediate, which can be used to synthesize a variety of important drugs, such as anticancer drugs, antiviral drugs and anticoagulant drugs.
2. Chemical research: 1H-Purine, 2-chloro-can also be used as a reagent or catalyst in chemical synthesis reactions.
Method:
1H-Purine, 2-chloro-has many preparation methods, common methods include:
1. Hydrazine reacts with chloroacetic acid to generate 1H-Purine, 2-chloro-.
2. P-chlorobenzamide can also be reacted with aminotoluidine to produce 1H-Purine, 2-chloro-.
The specific preparation process also needs to be adjusted according to the specific experimental conditions.
Safety Information:
1. 1H-purine, 2-chloro-is a chemical substance, which needs to be handled in accordance with relevant safety regulations.
2. When using or storing 1H-Purine, 2-chloro-, avoid contact with oxidants, strong acids and strong bases to avoid dangerous reactions.
3. In contact with 1H-Purine, 2-chloro-laboratory personnel should wear appropriate personal protective equipment, such as gloves and goggles.
4. If you accidentally inhale or ingest 1H-Purine, 2-chlorine-, you should see a doctor in time and inform the doctor of the relevant situation.
5.1 H-purine, 2-chlorine-may also cause harm to the aquatic environment and avoid discharge into water bodies.
Nature:
1. Appearance: 1H-Purine, 2-chlorine-is a colorless crystalline solid.
2. Melting Point: about 287-290 degrees Celsius.
3. Solubility: 1H-Purine, 2-chloro-insoluble in water, but soluble in organic solvents such as methanol, ethanol and dimethyl sulfoxide.
4. Stability: relatively stable at room temperature, but easy to decompose under higher temperature and light conditions.
Use:
1. Drug: 1H-Purine, 2-chlorine-is an important drug intermediate, which can be used to synthesize a variety of important drugs, such as anticancer drugs, antiviral drugs and anticoagulant drugs.
2. Chemical research: 1H-Purine, 2-chloro-can also be used as a reagent or catalyst in chemical synthesis reactions.
Method:
1H-Purine, 2-chloro-has many preparation methods, common methods include:
1. Hydrazine reacts with chloroacetic acid to generate 1H-Purine, 2-chloro-.
2. P-chlorobenzamide can also be reacted with aminotoluidine to produce 1H-Purine, 2-chloro-.
The specific preparation process also needs to be adjusted according to the specific experimental conditions.
Safety Information:
1. 1H-purine, 2-chloro-is a chemical substance, which needs to be handled in accordance with relevant safety regulations.
2. When using or storing 1H-Purine, 2-chloro-, avoid contact with oxidants, strong acids and strong bases to avoid dangerous reactions.
3. In contact with 1H-Purine, 2-chloro-laboratory personnel should wear appropriate personal protective equipment, such as gloves and goggles.
4. If you accidentally inhale or ingest 1H-Purine, 2-chlorine-, you should see a doctor in time and inform the doctor of the relevant situation.
5.1 H-purine, 2-chlorine-may also cause harm to the aquatic environment and avoid discharge into water bodies.
Last Update：2024-04-09 02:00:42
Supplier List
Product Name: 2-Chloropurine Visit Supplier Webpage Request for quotation
CAS: 1681-15-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 1681-15-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 2-Chloropurine Visit Supplier Webpage Request for quotation
CAS: 1681-15-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 1681-15-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History